C26H28FNO2 — CID 18396987
ethyl (3R)-3-(N-benzyl-3-fluoroanilino)-4-phenylpentanoate (PubChem CID 18396987) has the molecular formula C26H28FNO2 and a molecular weight of 405.51 g/mol. Its IUPAC name is ethyl (3R)-3-(N-benzyl-3-fluoroanilino)-4-phenylpentanoate.
| Compound Name | ethyl (3R)-3-(N-benzyl-3-fluoroanilino)-4-phenylpentanoate |
|---|---|
| PubChem CID | 18396987 |
| Molecular Formula | C26H28FNO2 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | ethyl (3R)-3-(N-benzyl-3-fluoroanilino)-4-phenylpentanoate |
| SMILES | CCOC(=O)C[C@H](C(C)c1ccccc1)N(Cc1ccccc1)c1cccc(F)c1 |
| InChI | InChI=1S/C26H28FNO2/c1-3-30-26(29)18-25(20(2)22-13-8-5-9-14-22)28(19-21-11-6-4-7-12-21)24-16-10-15-23(27)17-24/h4-17,20,25H,3,18-19H2,1-2H3/t20?,25-/m1/s1 |
| InChIKey | GQXJEXYCGRKRPE-GBAXHLBXSA-N |
| XLogP | 5.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |