C16H21NO3S2 — CID 18397272
(4S)-3-[(2S)-2-benzyl-3-sulfanylpropanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 18397272) has the molecular formula C16H21NO3S2 and a molecular weight of 339.48 g/mol. Its IUPAC name is (4S)-3-[(2S)-2-benzyl-3-sulfanylpropanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4S)-3-[(2S)-2-benzyl-3-sulfanylpropanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 18397272 |
| Molecular Formula | C16H21NO3S2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | (4S)-3-[(2S)-2-benzyl-3-sulfanylpropanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC1(C)SCN(C(=O)[C@@H](CS)Cc2ccccc2)[C@H]1C(=O)O |
| InChI | InChI=1S/C16H21NO3S2/c1-16(2)13(15(19)20)17(10-22-16)14(18)12(9-21)8-11-6-4-3-5-7-11/h3-7,12-13,21H,8-10H2,1-2H3,(H,19,20)/t12-,13+/m1/s1 |
| InChIKey | DBAXHUJPNUIUCI-OLZOCXBDSA-N |
| XLogP | 2.54 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|