C12H19NO4S2 — CID 18397280
(4S)-3-(3-acetylsulfanyl-2-methylpropanoyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 18397280) has the molecular formula C12H19NO4S2 and a molecular weight of 305.42 g/mol. Its IUPAC name is (4S)-3-(3-acetylsulfanyl-2-methylpropanoyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4S)-3-(3-acetylsulfanyl-2-methylpropanoyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 18397280 |
| Molecular Formula | C12H19NO4S2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | (4S)-3-(3-acetylsulfanyl-2-methylpropanoyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC(=O)SCC(C)C(=O)N1CSC(C)(C)[C@@H]1C(=O)O |
| InChI | InChI=1S/C12H19NO4S2/c1-7(5-18-8(2)14)10(15)13-6-19-12(3,4)9(13)11(16)17/h7,9H,5-6H2,1-4H3,(H,16,17)/t7?,9-/m0/s1 |
| InChIKey | KMGHKNBSLPZKEB-NETXQHHPSA-N |
| XLogP | 1.67 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|