C13H17NO6 — CID 18397305
(1R,2R,4S,6S,10S)-10-(ethylcarbamoyloxy)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylic acid (PubChem CID 18397305) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is (1R,2R,4S,6S,10S)-10-(ethylcarbamoyloxy)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylic acid.
| Compound Name | (1R,2R,4S,6S,10S)-10-(ethylcarbamoyloxy)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylic acid |
|---|---|
| PubChem CID | 18397305 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | (1R,2R,4S,6S,10S)-10-(ethylcarbamoyloxy)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylic acid |
| SMILES | CCNC(=O)O[C@@H]1OC=C(C(=O)O)[C@H]2C[C@@H]3O[C@]3(C)[C@H]12 |
| InChI | InChI=1S/C13H17NO6/c1-3-14-12(17)19-11-9-6(4-8-13(9,2)20-8)7(5-18-11)10(15)16/h5-6,8-9,11H,3-4H2,1-2H3,(H,14,17)(H,15,16)/t6-,8+,9+,11+,13+/m1/s1 |
| InChIKey | ACYBZLGLQLJZFD-LMPJBYECSA-N |
| XLogP | 0.85 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|