C14H21FO5 — CID 18397316
(1S,4S,4aS,7aR)-1-(1-ethoxyethoxy)-7-(fluoromethyl)-1,3,4,4a,5,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid (PubChem CID 18397316) has the molecular formula C14H21FO5 and a molecular weight of 288.32 g/mol. Its IUPAC name is (1S,4S,4aS,7aR)-1-(1-ethoxyethoxy)-7-(fluoromethyl)-1,3,4,4a,5,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid.
| Compound Name | (1S,4S,4aS,7aR)-1-(1-ethoxyethoxy)-7-(fluoromethyl)-1,3,4,4a,5,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid |
|---|---|
| PubChem CID | 18397316 |
| Molecular Formula | C14H21FO5 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (1S,4S,4aS,7aR)-1-(1-ethoxyethoxy)-7-(fluoromethyl)-1,3,4,4a,5,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid |
| SMILES | CCOC(C)O[C@@H]1OC[C@@H](C(=O)O)[C@H]2CC=C(CF)[C@H]12 |
| InChI | InChI=1S/C14H21FO5/c1-3-18-8(2)20-14-12-9(6-15)4-5-10(12)11(7-19-14)13(16)17/h4,8,10-12,14H,3,5-7H2,1-2H3,(H,16,17)/t8?,10-,11-,12+,14+/m1/s1 |
| InChIKey | IXTFAWKTOMXKJL-UVIPKCIBSA-N |
| XLogP | 1.97 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|