C14H18O6 — CID 18397317
(1S,4aS,7aR)-1-(1-ethoxyethoxy)-7-formyl-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid (PubChem CID 18397317) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is (1S,4aS,7aR)-1-(1-ethoxyethoxy)-7-formyl-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid.
| Compound Name | (1S,4aS,7aR)-1-(1-ethoxyethoxy)-7-formyl-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid |
|---|---|
| PubChem CID | 18397317 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | (1S,4aS,7aR)-1-(1-ethoxyethoxy)-7-formyl-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid |
| SMILES | CCOC(C)O[C@@H]1OC=C(C(=O)O)[C@H]2CC=C(C=O)[C@H]12 |
| InChI | InChI=1S/C14H18O6/c1-3-18-8(2)20-14-12-9(6-15)4-5-10(12)11(7-19-14)13(16)17/h4,6-8,10,12,14H,3,5H2,1-2H3,(H,16,17)/t8?,10-,12+,14+/m1/s1 |
| InChIKey | TYVPIHHTZIDCOX-DLGKRSOISA-N |
| XLogP | 1.47 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|