C37H58O6 — CID 18397858
4-O-[[(5aR,5bR,11aR)-9-acetyloxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl]methyl] 1-O-methyl butanedioate (PubChem CID 18397858) has the molecular formula C37H58O6 and a molecular weight of 598.87 g/mol. Its IUPAC name is 4-O-[[(5aR,5bR,11aR)-9-acetyloxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl]methyl] 1-O-methyl butanedioate.
| Compound Name | 4-O-[[(5aR,5bR,11aR)-9-acetyloxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl]methyl] 1-O-methyl butanedioate |
|---|---|
| PubChem CID | 18397858 |
| Molecular Formula | C37H58O6 |
| Molecular Weight | 598.87 g/mol |
| Exact Mass | 598.42 |
| IUPAC Name | 4-O-[[(5aR,5bR,11aR)-9-acetyloxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl]methyl] 1-O-methyl butanedioate |
| SMILES | C=C(C)C1CCC2(COC(=O)CCC(=O)OC)CC[C@]3(C)C(CCC4[C@@]5(C)CCC(OC(C)=O)C(C)(C)C5CC[C@]43C)C12 |
| InChI | InChI=1S/C37H58O6/c1-23(2)25-14-19-37(22-42-31(40)13-12-30(39)41-9)21-20-35(7)26(32(25)37)10-11-28-34(6)17-16-29(43-24(3)38)33(4,5)27(34)15-18-36(28,35)8/h25-29,32H,1,10-22H2,2-9H3/t25?,26?,27?,28?,29?,32?,34-,35+,36+,37?/m0/s1 |
| InChIKey | JQKSESDBFXGNIL-BSKVIZMUSA-N |
| XLogP | 8.07 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.87 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|