About 3-ethyl-1,2-dimethoxypentane
3-ethyl-1,2-dimethoxypentane (PubChem CID 18398351) has the molecular formula C9H20O2
and a molecular weight of 160.26 g/mol. Its IUPAC name is 3-ethyl-1,2-dimethoxypentane.
Molecular Properties
| Compound Name | 3-ethyl-1,2-dimethoxypentane |
| PubChem CID | 18398351 |
| Molecular Formula | C9H20O2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.15 |
| IUPAC Name | 3-ethyl-1,2-dimethoxypentane |
| SMILES | CCC(CC)C(COC)OC |
| InChI | InChI=1S/C9H20O2/c1-5-8(6-2)9(11-4)7-10-3/h8-9H,5-7H2,1-4H3 |
| InChIKey | YZFPEJZFFRGGIF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-1,2-dimethoxypentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,2-dimethoxypentane?
The IUPAC name of 3-ethyl-1,2-dimethoxypentane (CID 18398351) is 3-ethyl-1,2-dimethoxypentane.
What is the SMILES notation for 3-ethyl-1,2-dimethoxypentane?
The canonical SMILES for 3-ethyl-1,2-dimethoxypentane is CCC(CC)C(COC)OC.
What is the InChIKey of 3-ethyl-1,2-dimethoxypentane?
The InChIKey is YZFPEJZFFRGGIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O2/c1-5-8(6-2)9(11-4)7-10-3/h8-9H,5-7H2,1-4H3.
What are the key properties of 3-ethyl-1,2-dimethoxypentane?
3-ethyl-1,2-dimethoxypentane has a molecular weight of 160.26 g/mol, XLogP of 2.08, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,2-dimethoxypentane is sourced from PubChem (CID 18398351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).