3-phenyliminopropanoic acid

C9H9NO2 — CID 18398512

IUPAC3-phenyliminopropanoic acid
SMILESO=C(O)C/C=N/c1ccccc1
InChIInChI=1S/C9H9NO2/c11-9(12)6-7-10-8-4-2-1-3-5-8/h1-5,7H,6H2,(H,11,12)/b10-7+
InChIKeyNGFSQYKGUPPMBX-JXMROGBWSA-N
MW163.18 g/mol
LogP1.86
Rot. Bonds3

About 3-phenyliminopropanoic acid

3-phenyliminopropanoic acid (PubChem CID 18398512) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 3-phenyliminopropanoic acid.

Molecular Properties

Compound Name3-phenyliminopropanoic acid
PubChem CID18398512
Molecular FormulaC9H9NO2
Molecular Weight163.18 g/mol
Exact Mass163.06
IUPAC Name3-phenyliminopropanoic acid
SMILESO=C(O)C/C=N/c1ccccc1
InChIInChI=1S/C9H9NO2/c11-9(12)6-7-10-8-4-2-1-3-5-8/h1-5,7H,6H2,(H,11,12)/b10-7+
InChIKeyNGFSQYKGUPPMBX-JXMROGBWSA-N
XLogP1.86
TPSA49.66 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500163.18
LogP ≤ 51.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze 3-phenyliminopropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-phenyliminopropanoic acid?
The IUPAC name of 3-phenyliminopropanoic acid (CID 18398512) is 3-phenyliminopropanoic acid.
What is the SMILES notation for 3-phenyliminopropanoic acid?
The canonical SMILES for 3-phenyliminopropanoic acid is O=C(O)C/C=N/c1ccccc1.
What is the InChIKey of 3-phenyliminopropanoic acid?
The InChIKey is NGFSQYKGUPPMBX-JXMROGBWSA-N. The full InChI is InChI=1S/C9H9NO2/c11-9(12)6-7-10-8-4-2-1-3-5-8/h1-5,7H,6H2,(H,11,12)/b10-7+.
What are the key properties of 3-phenyliminopropanoic acid?
3-phenyliminopropanoic acid has a molecular weight of 163.18 g/mol, XLogP of 1.86, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyliminopropanoic acid is sourced from PubChem (CID 18398512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).