C7H7F5O2 — CID 18398515
5,5,6,6,6-pentafluoro-2-methylidenehexanoic acid (PubChem CID 18398515) has the molecular formula C7H7F5O2 and a molecular weight of 218.12 g/mol. Its IUPAC name is 5,5,6,6,6-pentafluoro-2-methylidenehexanoic acid.
| Compound Name | 5,5,6,6,6-pentafluoro-2-methylidenehexanoic acid |
|---|---|
| PubChem CID | 18398515 |
| Molecular Formula | C7H7F5O2 |
| Molecular Weight | 218.12 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 5,5,6,6,6-pentafluoro-2-methylidenehexanoic acid |
| SMILES | C=C(CCC(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C7H7F5O2/c1-4(5(13)14)2-3-6(8,9)7(10,11)12/h1-3H2,(H,13,14) |
| InChIKey | JWZUHMVWUVIKAS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.12 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|