About 1,1'-biphenyl;bromomethylbenzene
1,1'-biphenyl;bromomethylbenzene (PubChem CID 18398670) has the molecular formula C19H17Br
and a molecular weight of 325.25 g/mol. Its IUPAC name is 1,1'-biphenyl;bromomethylbenzene.
Molecular Properties
| Compound Name | 1,1'-biphenyl;bromomethylbenzene |
| PubChem CID | 18398670 |
| Molecular Formula | C19H17Br |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 1,1'-biphenyl;bromomethylbenzene |
| SMILES | BrCc1ccccc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C7H7Br/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;8-6-7-4-2-1-3-5-7/h1-10H;1-5H,6H2 |
| InChIKey | RXKZVEDIOCEXPV-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;bromomethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;bromomethylbenzene?
The IUPAC name of 1,1'-biphenyl;bromomethylbenzene (CID 18398670) is 1,1'-biphenyl;bromomethylbenzene.
What is the SMILES notation for 1,1'-biphenyl;bromomethylbenzene?
The canonical SMILES for 1,1'-biphenyl;bromomethylbenzene is BrCc1ccccc1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;bromomethylbenzene?
The InChIKey is RXKZVEDIOCEXPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C7H7Br/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;8-6-7-4-2-1-3-5-7/h1-10H;1-5H,6H2.
What are the key properties of 1,1'-biphenyl;bromomethylbenzene?
1,1'-biphenyl;bromomethylbenzene has a molecular weight of 325.25 g/mol, XLogP of 5.94, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;bromomethylbenzene is sourced from PubChem (CID 18398670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).