C34H32Cl2N2O8 — CID 18398816
methyl 2-(4-aminophenyl)-4-(4-chloro-3,5-dimethoxyphenyl)-7-[(3,5-dimethoxyphenyl)methoxy]-1-oxoisoquinoline-3-carboxylate;hydrochloride (PubChem CID 18398816) has the molecular formula C34H32Cl2N2O8 and a molecular weight of 667.54 g/mol. Its IUPAC name is methyl 2-(4-aminophenyl)-4-(4-chloro-3,5-dimethoxyphenyl)-7-[(3,5-dimethoxyphenyl)methoxy]-1-oxoisoquinoline-3-carboxylate;hydrochloride.
| Compound Name | methyl 2-(4-aminophenyl)-4-(4-chloro-3,5-dimethoxyphenyl)-7-[(3,5-dimethoxyphenyl)methoxy]-1-oxoisoquinoline-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 18398816 |
| Molecular Formula | C34H32Cl2N2O8 |
| Molecular Weight | 667.54 g/mol |
| Exact Mass | 666.15 |
| IUPAC Name | methyl 2-(4-aminophenyl)-4-(4-chloro-3,5-dimethoxyphenyl)-7-[(3,5-dimethoxyphenyl)methoxy]-1-oxoisoquinoline-3-carboxylate;hydrochloride |
| SMILES | COC(=O)c1c(-c2cc(OC)c(Cl)c(OC)c2)c2ccc(OCc3cc(OC)cc(OC)c3)cc2c(=O)n1-c1ccc(N)cc1.Cl |
| InChI | InChI=1S/C34H31ClN2O8.ClH/c1-40-24-12-19(13-25(16-24)41-2)18-45-23-10-11-26-27(17-23)33(38)37(22-8-6-21(36)7-9-22)32(34(39)44-5)30(26)20-14-28(42-3)31(35)29(15-20)43-4;/h6-17H,18,36H2,1-5H3;1H |
| InChIKey | LXDBTBMZUBVNCR-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.54 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|