C34H33ClN2O8 — CID 18399369
methyl 2-(4-aminophenyl)-7-[[4-(hydroxymethyl)phenyl]methoxy]-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;hydrochloride (PubChem CID 18399369) has the molecular formula C34H33ClN2O8 and a molecular weight of 633.10 g/mol. Its IUPAC name is methyl 2-(4-aminophenyl)-7-[[4-(hydroxymethyl)phenyl]methoxy]-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;hydrochloride.
| Compound Name | methyl 2-(4-aminophenyl)-7-[[4-(hydroxymethyl)phenyl]methoxy]-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 18399369 |
| Molecular Formula | C34H33ClN2O8 |
| Molecular Weight | 633.10 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | methyl 2-(4-aminophenyl)-7-[[4-(hydroxymethyl)phenyl]methoxy]-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;hydrochloride |
| SMILES | COC(=O)c1c(-c2cc(OC)c(OC)c(OC)c2)c2ccc(OCc3ccc(CO)cc3)cc2c(=O)n1-c1ccc(N)cc1.Cl |
| InChI | InChI=1S/C34H32N2O8.ClH/c1-40-28-15-22(16-29(41-2)32(28)42-3)30-26-14-13-25(44-19-21-7-5-20(18-37)6-8-21)17-27(26)33(38)36(31(30)34(39)43-4)24-11-9-23(35)10-12-24;/h5-17,37H,18-19,35H2,1-4H3;1H |
| InChIKey | COVKIOMWSJLGSF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.10 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|