About thieno[3,2-b]pyran-7-one
thieno[3,2-b]pyran-7-one (PubChem CID 18399618) has the molecular formula C7H4O2S
and a molecular weight of 152.17 g/mol. Its IUPAC name is thieno[3,2-b]pyran-7-one.
Molecular Properties
| Compound Name | thieno[3,2-b]pyran-7-one |
| PubChem CID | 18399618 |
| Molecular Formula | C7H4O2S |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 151.99 |
| IUPAC Name | thieno[3,2-b]pyran-7-one |
| SMILES | O=c1ccoc2ccsc12 |
| InChI | InChI=1S/C7H4O2S/c8-5-1-3-9-6-2-4-10-7(5)6/h1-4H |
| InChIKey | OVJIOJPHJYSSSX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thieno[3,2-b]pyran-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[3,2-b]pyran-7-one?
The IUPAC name of thieno[3,2-b]pyran-7-one (CID 18399618) is thieno[3,2-b]pyran-7-one.
What is the SMILES notation for thieno[3,2-b]pyran-7-one?
The canonical SMILES for thieno[3,2-b]pyran-7-one is O=c1ccoc2ccsc12.
What is the InChIKey of thieno[3,2-b]pyran-7-one?
The InChIKey is OVJIOJPHJYSSSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4O2S/c8-5-1-3-9-6-2-4-10-7(5)6/h1-4H.
What are the key properties of thieno[3,2-b]pyran-7-one?
thieno[3,2-b]pyran-7-one has a molecular weight of 152.17 g/mol, XLogP of 1.85, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,2-b]pyran-7-one is sourced from PubChem (CID 18399618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).