About 6-amino-3,3-dimethyl-1,2-dihydroinden-1-ol
6-amino-3,3-dimethyl-1,2-dihydroinden-1-ol (PubChem CID 18399977) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 6-amino-3,3-dimethyl-1,2-dihydroinden-1-ol.
Molecular Properties
| Compound Name | 6-amino-3,3-dimethyl-1,2-dihydroinden-1-ol |
| PubChem CID | 18399977 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 6-amino-3,3-dimethyl-1,2-dihydroinden-1-ol |
| SMILES | CC1(C)CC(O)c2cc(N)ccc21 |
| InChI | InChI=1S/C11H15NO/c1-11(2)6-10(13)8-5-7(12)3-4-9(8)11/h3-5,10,13H,6,12H2,1-2H3 |
| InChIKey | JLXSVICIDAARHB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-3,3-dimethyl-1,2-dihydroinden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3,3-dimethyl-1,2-dihydroinden-1-ol?
The IUPAC name of 6-amino-3,3-dimethyl-1,2-dihydroinden-1-ol (CID 18399977) is 6-amino-3,3-dimethyl-1,2-dihydroinden-1-ol.
What is the SMILES notation for 6-amino-3,3-dimethyl-1,2-dihydroinden-1-ol?
The canonical SMILES for 6-amino-3,3-dimethyl-1,2-dihydroinden-1-ol is CC1(C)CC(O)c2cc(N)ccc21.
What is the InChIKey of 6-amino-3,3-dimethyl-1,2-dihydroinden-1-ol?
The InChIKey is JLXSVICIDAARHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-11(2)6-10(13)8-5-7(12)3-4-9(8)11/h3-5,10,13H,6,12H2,1-2H3.
What are the key properties of 6-amino-3,3-dimethyl-1,2-dihydroinden-1-ol?
6-amino-3,3-dimethyl-1,2-dihydroinden-1-ol has a molecular weight of 177.25 g/mol, XLogP of 1.98, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3,3-dimethyl-1,2-dihydroinden-1-ol is sourced from PubChem (CID 18399977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).