C13H6Cl7N3 — CID 18400263
2-[(E)-2-(4-chlorophenyl)ethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine (PubChem CID 18400263) has the molecular formula C13H6Cl7N3 and a molecular weight of 452.38 g/mol. Its IUPAC name is 2-[(E)-2-(4-chlorophenyl)ethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-[(E)-2-(4-chlorophenyl)ethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 18400263 |
| Molecular Formula | C13H6Cl7N3 |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 448.84 |
| IUPAC Name | 2-[(E)-2-(4-chlorophenyl)ethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine |
| SMILES | Clc1ccc(/C=C/c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C13H6Cl7N3/c14-8-4-1-7(2-5-8)3-6-9-21-10(12(15,16)17)23-11(22-9)13(18,19)20/h1-6H/b6-3+ |
| InChIKey | JWKRKQYJIZLNFB-ZZXKWVIFSA-N |
| XLogP | 6.35 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|