About ditert-butylalumanylium;2-methylpropan-2-olate
ditert-butylalumanylium;2-methylpropan-2-olate (PubChem CID 18400427) has the molecular formula C12H27AlO
and a molecular weight of 214.33 g/mol. Its IUPAC name is ditert-butylalumanylium;2-methylpropan-2-olate.
Molecular Properties
| Compound Name | ditert-butylalumanylium;2-methylpropan-2-olate |
| PubChem CID | 18400427 |
| Molecular Formula | C12H27AlO |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | ditert-butylalumanylium;2-methylpropan-2-olate |
| SMILES | CC(C)(C)[Al+]C(C)(C)C.CC(C)(C)[O-] |
| InChI | InChI=1S/C4H9O.2C4H9.Al/c1-4(2,3)5;2*1-4(2)3;/h1-3H3;2*1-3H3;/q-1;;;+1 |
| InChIKey | SYLCOAAFMGOGEN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ditert-butylalumanylium;2-methylpropan-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butylalumanylium;2-methylpropan-2-olate?
The IUPAC name of ditert-butylalumanylium;2-methylpropan-2-olate (CID 18400427) is ditert-butylalumanylium;2-methylpropan-2-olate.
What is the SMILES notation for ditert-butylalumanylium;2-methylpropan-2-olate?
The canonical SMILES for ditert-butylalumanylium;2-methylpropan-2-olate is CC(C)(C)[Al+]C(C)(C)C.CC(C)(C)[O-].
What is the InChIKey of ditert-butylalumanylium;2-methylpropan-2-olate?
The InChIKey is SYLCOAAFMGOGEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O.2C4H9.Al/c1-4(2,3)5;2*1-4(2)3;/h1-3H3;2*1-3H3;/q-1;;;+1.
What are the key properties of ditert-butylalumanylium;2-methylpropan-2-olate?
ditert-butylalumanylium;2-methylpropan-2-olate has a molecular weight of 214.33 g/mol, XLogP of 3.27, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butylalumanylium;2-methylpropan-2-olate is sourced from PubChem (CID 18400427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).