About (Z)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-thiophen-2-ylprop-2-enamide
(Z)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-thiophen-2-ylprop-2-enamide (PubChem CID 18400558) has the molecular formula C14H11N3OS
and a molecular weight of 269.33 g/mol. Its IUPAC name is (Z)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-thiophen-2-ylprop-2-enamide.
Molecular Properties
| Compound Name | (Z)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-thiophen-2-ylprop-2-enamide |
| PubChem CID | 18400558 |
| Molecular Formula | C14H11N3OS |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | (Z)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-thiophen-2-ylprop-2-enamide |
| SMILES | NC(=O)/C(=C/c1c[nH]c2ncccc12)c1cccs1 |
| InChI | InChI=1S/C14H11N3OS/c15-13(18)11(12-4-2-6-19-12)7-9-8-17-14-10(9)3-1-5-16-14/h1-8H,(H2,15,18)(H,16,17)/b11-7+ |
| InChIKey | VPWFZMHGYNCTHF-YRNVUSSQSA-N |
| XLogP | 2.65 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-thiophen-2-ylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-thiophen-2-ylprop-2-enamide?
The IUPAC name of (Z)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-thiophen-2-ylprop-2-enamide (CID 18400558) is (Z)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-thiophen-2-ylprop-2-enamide.
What is the SMILES notation for (Z)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-thiophen-2-ylprop-2-enamide?
The canonical SMILES for (Z)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-thiophen-2-ylprop-2-enamide is NC(=O)/C(=C/c1c[nH]c2ncccc12)c1cccs1.
What is the InChIKey of (Z)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-thiophen-2-ylprop-2-enamide?
The InChIKey is VPWFZMHGYNCTHF-YRNVUSSQSA-N. The full InChI is InChI=1S/C14H11N3OS/c15-13(18)11(12-4-2-6-19-12)7-9-8-17-14-10(9)3-1-5-16-14/h1-8H,(H2,15,18)(H,16,17)/b11-7+.
What are the key properties of (Z)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-thiophen-2-ylprop-2-enamide?
(Z)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-thiophen-2-ylprop-2-enamide has a molecular weight of 269.33 g/mol, XLogP of 2.65, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-thiophen-2-ylprop-2-enamide is sourced from PubChem (CID 18400558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).