C23H20N4O4S — CID 18400582
(E)-2-phenyl-3-[6-[(4-sulfamoylphenyl)methylamino]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid (PubChem CID 18400582) has the molecular formula C23H20N4O4S and a molecular weight of 448.50 g/mol. Its IUPAC name is (E)-2-phenyl-3-[6-[(4-sulfamoylphenyl)methylamino]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid.
| Compound Name | (E)-2-phenyl-3-[6-[(4-sulfamoylphenyl)methylamino]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 18400582 |
| Molecular Formula | C23H20N4O4S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | (E)-2-phenyl-3-[6-[(4-sulfamoylphenyl)methylamino]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid |
| SMILES | NS(=O)(=O)c1ccc(CNc2ccc3c(/C=C(/C(=O)O)c4ccccc4)c[nH]c3n2)cc1 |
| InChI | InChI=1S/C23H20N4O4S/c24-32(30,31)18-8-6-15(7-9-18)13-25-21-11-10-19-17(14-26-22(19)27-21)12-20(23(28)29)16-4-2-1-3-5-16/h1-12,14H,13H2,(H,28,29)(H2,24,30,31)(H2,25,26,27)/b20-12+ |
| InChIKey | WGPIQVPJCVXESU-UDWIEESQSA-N |
| XLogP | 3.45 |
| TPSA | 138.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|