C30H22F2N4O2 — CID 18400616
(E)-3-[6-[[2-[4-(2,5-difluorophenyl)phenyl]acetyl]amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enamide (PubChem CID 18400616) has the molecular formula C30H22F2N4O2 and a molecular weight of 508.53 g/mol. Its IUPAC name is (E)-3-[6-[[2-[4-(2,5-difluorophenyl)phenyl]acetyl]amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enamide.
| Compound Name | (E)-3-[6-[[2-[4-(2,5-difluorophenyl)phenyl]acetyl]amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 18400616 |
| Molecular Formula | C30H22F2N4O2 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | (E)-3-[6-[[2-[4-(2,5-difluorophenyl)phenyl]acetyl]amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enamide |
| SMILES | NC(=O)/C(=C/c1c[nH]c2nc(NC(=O)Cc3ccc(-c4cc(F)ccc4F)cc3)ccc12)c1ccccc1 |
| InChI | InChI=1S/C30H22F2N4O2/c31-22-10-12-26(32)24(16-22)20-8-6-18(7-9-20)14-28(37)35-27-13-11-23-21(17-34-30(23)36-27)15-25(29(33)38)19-4-2-1-3-5-19/h1-13,15-17H,14H2,(H2,33,38)(H2,34,35,36,37)/b25-15+ |
| InChIKey | LXRONMVAQKMSFY-MFKUBSTISA-N |
| XLogP | 5.72 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|