About acetamide;propanamide
acetamide;propanamide (PubChem CID 18401246) has the molecular formula C5H12N2O2
and a molecular weight of 132.16 g/mol. Its IUPAC name is acetamide;propanamide.
Molecular Properties
| Compound Name | acetamide;propanamide |
| PubChem CID | 18401246 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | acetamide;propanamide |
| SMILES | CC(N)=O.CCC(N)=O |
| InChI | InChI=1S/C3H7NO.C2H5NO/c1-2-3(4)5;1-2(3)4/h2H2,1H3,(H2,4,5);1H3,(H2,3,4) |
| InChIKey | SUSMHLGLLFPYER-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetamide;propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;propanamide?
The IUPAC name of acetamide;propanamide (CID 18401246) is acetamide;propanamide.
What is the SMILES notation for acetamide;propanamide?
The canonical SMILES for acetamide;propanamide is CC(N)=O.CCC(N)=O.
What is the InChIKey of acetamide;propanamide?
The InChIKey is SUSMHLGLLFPYER-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.C2H5NO/c1-2-3(4)5;1-2(3)4/h2H2,1H3,(H2,4,5);1H3,(H2,3,4).
What are the key properties of acetamide;propanamide?
acetamide;propanamide has a molecular weight of 132.16 g/mol, XLogP of -0.63, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;propanamide is sourced from PubChem (CID 18401246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).