About butylazanium;tetraphenylboranuide
butylazanium;tetraphenylboranuide (PubChem CID 18401350) has the molecular formula C28H32BN
and a molecular weight of 393.38 g/mol. Its IUPAC name is butylazanium;tetraphenylboranuide.
Molecular Properties
| Compound Name | butylazanium;tetraphenylboranuide |
| PubChem CID | 18401350 |
| Molecular Formula | C28H32BN |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | butylazanium;tetraphenylboranuide |
| SMILES | CCCC[NH3+].c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C4H11N/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-2-3-4-5/h1-20H;2-5H2,1H3/q-1;/p+1 |
| InChIKey | HKJNOWZBUJQYPU-UHFFFAOYSA-O |
| XLogP | 3.09 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butylazanium;tetraphenylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylazanium;tetraphenylboranuide?
The IUPAC name of butylazanium;tetraphenylboranuide (CID 18401350) is butylazanium;tetraphenylboranuide.
What is the SMILES notation for butylazanium;tetraphenylboranuide?
The canonical SMILES for butylazanium;tetraphenylboranuide is CCCC[NH3+].c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of butylazanium;tetraphenylboranuide?
The InChIKey is HKJNOWZBUJQYPU-UHFFFAOYSA-O. The full InChI is InChI=1S/C24H20B.C4H11N/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-2-3-4-5/h1-20H;2-5H2,1H3/q-1;/p+1.
What are the key properties of butylazanium;tetraphenylboranuide?
butylazanium;tetraphenylboranuide has a molecular weight of 393.38 g/mol, XLogP of 3.09, 6 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butylazanium;tetraphenylboranuide is sourced from PubChem (CID 18401350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).