About 2-(4-chloro-1-methylcyclohexa-2,4-dien-1-yl)oxyacetic acid
2-(4-chloro-1-methylcyclohexa-2,4-dien-1-yl)oxyacetic acid (PubChem CID 18401353) has the molecular formula C9H11ClO3
and a molecular weight of 202.64 g/mol. Its IUPAC name is 2-(4-chloro-1-methylcyclohexa-2,4-dien-1-yl)oxyacetic acid.
Molecular Properties
| Compound Name | 2-(4-chloro-1-methylcyclohexa-2,4-dien-1-yl)oxyacetic acid |
| PubChem CID | 18401353 |
| Molecular Formula | C9H11ClO3 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 2-(4-chloro-1-methylcyclohexa-2,4-dien-1-yl)oxyacetic acid |
| SMILES | CC1(OCC(=O)O)C=CC(Cl)=CC1 |
| InChI | InChI=1S/C9H11ClO3/c1-9(13-6-8(11)12)4-2-7(10)3-5-9/h2-4H,5-6H2,1H3,(H,11,12) |
| InChIKey | FLNGZLIXHKKSGN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-chloro-1-methylcyclohexa-2,4-dien-1-yl)oxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-1-methylcyclohexa-2,4-dien-1-yl)oxyacetic acid?
The IUPAC name of 2-(4-chloro-1-methylcyclohexa-2,4-dien-1-yl)oxyacetic acid (CID 18401353) is 2-(4-chloro-1-methylcyclohexa-2,4-dien-1-yl)oxyacetic acid.
What is the SMILES notation for 2-(4-chloro-1-methylcyclohexa-2,4-dien-1-yl)oxyacetic acid?
The canonical SMILES for 2-(4-chloro-1-methylcyclohexa-2,4-dien-1-yl)oxyacetic acid is CC1(OCC(=O)O)C=CC(Cl)=CC1.
What is the InChIKey of 2-(4-chloro-1-methylcyclohexa-2,4-dien-1-yl)oxyacetic acid?
The InChIKey is FLNGZLIXHKKSGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClO3/c1-9(13-6-8(11)12)4-2-7(10)3-5-9/h2-4H,5-6H2,1H3,(H,11,12).
What are the key properties of 2-(4-chloro-1-methylcyclohexa-2,4-dien-1-yl)oxyacetic acid?
2-(4-chloro-1-methylcyclohexa-2,4-dien-1-yl)oxyacetic acid has a molecular weight of 202.64 g/mol, XLogP of 1.93, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-1-methylcyclohexa-2,4-dien-1-yl)oxyacetic acid is sourced from PubChem (CID 18401353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).