About zinc bis(2,3-di(nonyl)naphthalene-1-sulfonate)
zinc bis(2,3-di(nonyl)naphthalene-1-sulfonate) (PubChem CID 18401379) has the molecular formula C56H86O6S2Zn
and a molecular weight of 984.82 g/mol. Its IUPAC name is zinc bis(2,3-di(nonyl)naphthalene-1-sulfonate).
Molecular Properties
| Compound Name | zinc bis(2,3-di(nonyl)naphthalene-1-sulfonate) |
| PubChem CID | 18401379 |
| Molecular Formula | C56H86O6S2Zn |
| Molecular Weight | 984.82 g/mol |
| Exact Mass | 982.52 |
| IUPAC Name | zinc bis(2,3-di(nonyl)naphthalene-1-sulfonate) |
| SMILES | CCCCCCCCCc1cc2ccccc2c(S(=O)(=O)[O-])c1CCCCCCCCC.CCCCCCCCCc1cc2ccccc2c(S(=O)(=O)[O-])c1CCCCCCCCC.[Zn+2] |
| InChI | InChI=1S/2C28H44O3S.Zn/c2*1-3-5-7-9-11-13-15-19-24-23-25-20-17-18-22-27(25)28(32(29,30)31)26(24)21-16-14-12-10-8-6-4-2;/h2*17-18,20,22-23H,3-16,19,21H2,1-2H3,(H,29,30,31);/q;;+2/p-2 |
| InChIKey | COGHWIKGZJHSAG-UHFFFAOYSA-L |
| XLogP | 16.66 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 65 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 984.82 |
| LogP ≤ 5 | 16.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(2,3-di(nonyl)naphthalene-1-sulfonate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(2,3-di(nonyl)naphthalene-1-sulfonate)?
The IUPAC name of zinc bis(2,3-di(nonyl)naphthalene-1-sulfonate) (CID 18401379) is zinc bis(2,3-di(nonyl)naphthalene-1-sulfonate).
What is the SMILES notation for zinc bis(2,3-di(nonyl)naphthalene-1-sulfonate)?
The canonical SMILES for zinc bis(2,3-di(nonyl)naphthalene-1-sulfonate) is CCCCCCCCCc1cc2ccccc2c(S(=O)(=O)[O-])c1CCCCCCCCC.CCCCCCCCCc1cc2ccccc2c(S(=O)(=O)[O-])c1CCCCCCCCC.[Zn+2].
What is the InChIKey of zinc bis(2,3-di(nonyl)naphthalene-1-sulfonate)?
The InChIKey is COGHWIKGZJHSAG-UHFFFAOYSA-L. The full InChI is InChI=1S/2C28H44O3S.Zn/c2*1-3-5-7-9-11-13-15-19-24-23-25-20-17-18-22-27(25)28(32(29,30)31)26(24)21-16-14-12-10-8-6-4-2;/h2*17-18,20,22-23H,3-16,19,21H2,1-2H3,(H,29,30,31);/q;;+2/p-2.
What are the key properties of zinc bis(2,3-di(nonyl)naphthalene-1-sulfonate)?
zinc bis(2,3-di(nonyl)naphthalene-1-sulfonate) has a molecular weight of 984.82 g/mol, XLogP of 16.66, 34 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(2,3-di(nonyl)naphthalene-1-sulfonate) is sourced from PubChem (CID 18401379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).