C28H24F6N4O4 — CID 18401679
8-[3,5-bis(trifluoromethyl)benzoyl]-3-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-(2-methylphenyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 18401679) has the molecular formula C28H24F6N4O4 and a molecular weight of 594.51 g/mol. Its IUPAC name is 8-[3,5-bis(trifluoromethyl)benzoyl]-3-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-(2-methylphenyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[3,5-bis(trifluoromethyl)benzoyl]-3-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-(2-methylphenyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 18401679 |
| Molecular Formula | C28H24F6N4O4 |
| Molecular Weight | 594.51 g/mol |
| Exact Mass | 594.17 |
| IUPAC Name | 8-[3,5-bis(trifluoromethyl)benzoyl]-3-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-(2-methylphenyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1cc(CN2C(=O)N(c3ccccc3C)C3(CCN(C(=O)c4cc(C(F)(F)F)cc(C(F)(F)F)c4)CC3)C2=O)no1 |
| InChI | InChI=1S/C28H24F6N4O4/c1-16-5-3-4-6-22(16)38-25(41)37(15-21-11-17(2)42-35-21)24(40)26(38)7-9-36(10-8-26)23(39)18-12-19(27(29,30)31)14-20(13-18)28(32,33)34/h3-6,11-14H,7-10,15H2,1-2H3 |
| InChIKey | SWVQHIPKAMLZDO-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.51 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|