About chloro-hydroxy-oxosilane
chloro-hydroxy-oxosilane (PubChem CID 18401977) has the molecular formula HClO2Si
and a molecular weight of 96.54 g/mol. Its IUPAC name is chloro-hydroxy-oxosilane.
Molecular Properties
| Compound Name | chloro-hydroxy-oxosilane |
| PubChem CID | 18401977 |
| Molecular Formula | HClO2Si |
| Molecular Weight | 96.54 g/mol |
| Exact Mass | 95.94 |
| IUPAC Name | chloro-hydroxy-oxosilane |
| SMILES | O=[Si](O)Cl |
| InChI | InChI=1S/ClHO2Si/c1-4(2)3/h2H |
| InChIKey | MXOHMEUEGMEKQP-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 96.54 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chloro-hydroxy-oxosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-hydroxy-oxosilane?
The IUPAC name of chloro-hydroxy-oxosilane (CID 18401977) is chloro-hydroxy-oxosilane.
What is the SMILES notation for chloro-hydroxy-oxosilane?
The canonical SMILES for chloro-hydroxy-oxosilane is O=[Si](O)Cl.
What is the InChIKey of chloro-hydroxy-oxosilane?
The InChIKey is MXOHMEUEGMEKQP-UHFFFAOYSA-N. The full InChI is InChI=1S/ClHO2Si/c1-4(2)3/h2H.
What are the key properties of chloro-hydroxy-oxosilane?
chloro-hydroxy-oxosilane has a molecular weight of 96.54 g/mol, XLogP of -0.37, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-hydroxy-oxosilane is sourced from PubChem (CID 18401977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).