About 2,6-bis(2,4-dimethylphenyl)-4-methylpyrylium;trifluoromethanesulfonate
2,6-bis(2,4-dimethylphenyl)-4-methylpyrylium;trifluoromethanesulfonate (PubChem CID 18402137) has the molecular formula C23H23F3O4S
and a molecular weight of 452.49 g/mol. Its IUPAC name is 2,6-bis(2,4-dimethylphenyl)-4-methylpyrylium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 2,6-bis(2,4-dimethylphenyl)-4-methylpyrylium;trifluoromethanesulfonate |
| PubChem CID | 18402137 |
| Molecular Formula | C23H23F3O4S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 2,6-bis(2,4-dimethylphenyl)-4-methylpyrylium;trifluoromethanesulfonate |
| SMILES | Cc1cc(-c2ccc(C)cc2C)[o+]c(-c2ccc(C)cc2C)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C22H23O.CHF3O3S/c1-14-6-8-19(17(4)10-14)21-12-16(3)13-22(23-21)20-9-7-15(2)11-18(20)5;2-1(3,4)8(5,6)7/h6-13H,1-5H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | GDKIJRJKDMZFFB-UHFFFAOYSA-M |
| XLogP | 6.49 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 2,6-bis(2,4-dimethylphenyl)-4-methylpyrylium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(2,4-dimethylphenyl)-4-methylpyrylium;trifluoromethanesulfonate?
The IUPAC name of 2,6-bis(2,4-dimethylphenyl)-4-methylpyrylium;trifluoromethanesulfonate (CID 18402137) is 2,6-bis(2,4-dimethylphenyl)-4-methylpyrylium;trifluoromethanesulfonate.
What is the SMILES notation for 2,6-bis(2,4-dimethylphenyl)-4-methylpyrylium;trifluoromethanesulfonate?
The canonical SMILES for 2,6-bis(2,4-dimethylphenyl)-4-methylpyrylium;trifluoromethanesulfonate is Cc1cc(-c2ccc(C)cc2C)[o+]c(-c2ccc(C)cc2C)c1.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of 2,6-bis(2,4-dimethylphenyl)-4-methylpyrylium;trifluoromethanesulfonate?
The InChIKey is GDKIJRJKDMZFFB-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H23O.CHF3O3S/c1-14-6-8-19(17(4)10-14)21-12-16(3)13-22(23-21)20-9-7-15(2)11-18(20)5;2-1(3,4)8(5,6)7/h6-13H,1-5H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of 2,6-bis(2,4-dimethylphenyl)-4-methylpyrylium;trifluoromethanesulfonate?
2,6-bis(2,4-dimethylphenyl)-4-methylpyrylium;trifluoromethanesulfonate has a molecular weight of 452.49 g/mol, XLogP of 6.49, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(2,4-dimethylphenyl)-4-methylpyrylium;trifluoromethanesulfonate is sourced from PubChem (CID 18402137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).