C18H30O — CID 18402294
1,3-diethyl-3a,4,5,6,7,8,9,10,11,12-decahydro-3H-cyclopenta[11]annulen-2-one (PubChem CID 18402294) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is 1,3-diethyl-3a,4,5,6,7,8,9,10,11,12-decahydro-3H-cyclopenta[11]annulen-2-one.
| Compound Name | 1,3-diethyl-3a,4,5,6,7,8,9,10,11,12-decahydro-3H-cyclopenta[11]annulen-2-one |
|---|---|
| PubChem CID | 18402294 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 1,3-diethyl-3a,4,5,6,7,8,9,10,11,12-decahydro-3H-cyclopenta[11]annulen-2-one |
| SMILES | CCC1=C2CCCCCCCCCC2C(CC)C1=O |
| InChI | InChI=1S/C18H30O/c1-3-14-16-12-10-8-6-5-7-9-11-13-17(16)15(4-2)18(14)19/h14,16H,3-13H2,1-2H3 |
| InChIKey | ORMFBIDKUQVOEX-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |