C13H20 — CID 18402419
(3aZ,5Z)-1-ethyl-2,3,7,8,9,9a-hexahydro-1H-cyclopenta[8]annulene (PubChem CID 18402419) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is (3aZ,5Z)-1-ethyl-2,3,7,8,9,9a-hexahydro-1H-cyclopenta[8]annulene.
| Compound Name | (3aZ,5Z)-1-ethyl-2,3,7,8,9,9a-hexahydro-1H-cyclopenta[8]annulene |
|---|---|
| PubChem CID | 18402419 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | (3aZ,5Z)-1-ethyl-2,3,7,8,9,9a-hexahydro-1H-cyclopenta[8]annulene |
| SMILES | CCC1CC/C2=C/C=C\CCCC21 |
| InChI | InChI=1S/C13H20/c1-2-11-9-10-12-7-5-3-4-6-8-13(11)12/h3,5,7,11,13H,2,4,6,8-10H2,1H3/b5-3-,12-7- |
| InChIKey | RFLWICCZLUITCH-JWDUOXHJSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |