C16H26O — CID 18402424
3-ethyl-3a,4,5,6,7,8,9,10,11,12-decahydro-3H-cyclopenta[11]annulen-2-one (PubChem CID 18402424) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is 3-ethyl-3a,4,5,6,7,8,9,10,11,12-decahydro-3H-cyclopenta[11]annulen-2-one.
| Compound Name | 3-ethyl-3a,4,5,6,7,8,9,10,11,12-decahydro-3H-cyclopenta[11]annulen-2-one |
|---|---|
| PubChem CID | 18402424 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 3-ethyl-3a,4,5,6,7,8,9,10,11,12-decahydro-3H-cyclopenta[11]annulen-2-one |
| SMILES | CCC1C(=O)C=C2CCCCCCCCCC21 |
| InChI | InChI=1S/C16H26O/c1-2-14-15-11-9-7-5-3-4-6-8-10-13(15)12-16(14)17/h12,14-15H,2-11H2,1H3 |
| InChIKey | HYFNTMPWYWSMKM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |