About [4-(oxan-4-yl)phenyl] trifluoromethanesulfonate
[4-(oxan-4-yl)phenyl] trifluoromethanesulfonate (PubChem CID 18402509) has the molecular formula C12H13F3O4S
and a molecular weight of 310.29 g/mol. Its IUPAC name is [4-(oxan-4-yl)phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [4-(oxan-4-yl)phenyl] trifluoromethanesulfonate |
| PubChem CID | 18402509 |
| Molecular Formula | C12H13F3O4S |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | [4-(oxan-4-yl)phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(C2CCOCC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C12H13F3O4S/c13-12(14,15)20(16,17)19-11-3-1-9(2-4-11)10-5-7-18-8-6-10/h1-4,10H,5-8H2 |
| InChIKey | TYLQGUFVJUJSNG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [4-(oxan-4-yl)phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(oxan-4-yl)phenyl] trifluoromethanesulfonate?
The IUPAC name of [4-(oxan-4-yl)phenyl] trifluoromethanesulfonate (CID 18402509) is [4-(oxan-4-yl)phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [4-(oxan-4-yl)phenyl] trifluoromethanesulfonate?
The canonical SMILES for [4-(oxan-4-yl)phenyl] trifluoromethanesulfonate is O=S(=O)(Oc1ccc(C2CCOCC2)cc1)C(F)(F)F.
What is the InChIKey of [4-(oxan-4-yl)phenyl] trifluoromethanesulfonate?
The InChIKey is TYLQGUFVJUJSNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3O4S/c13-12(14,15)20(16,17)19-11-3-1-9(2-4-11)10-5-7-18-8-6-10/h1-4,10H,5-8H2.
What are the key properties of [4-(oxan-4-yl)phenyl] trifluoromethanesulfonate?
[4-(oxan-4-yl)phenyl] trifluoromethanesulfonate has a molecular weight of 310.29 g/mol, XLogP of 2.81, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(oxan-4-yl)phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 18402509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).