C27H31F6IO3S — CID 18402786
bis(4-cyclohexylphenyl)iodanium;1,1,2,2,3,3-hexafluoropropane-1-sulfonate (PubChem CID 18402786) has the molecular formula C27H31F6IO3S and a molecular weight of 676.50 g/mol. Its IUPAC name is bis(4-cyclohexylphenyl)iodanium;1,1,2,2,3,3-hexafluoropropane-1-sulfonate.
| Compound Name | bis(4-cyclohexylphenyl)iodanium;1,1,2,2,3,3-hexafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 18402786 |
| Molecular Formula | C27H31F6IO3S |
| Molecular Weight | 676.50 g/mol |
| Exact Mass | 676.09 |
| IUPAC Name | bis(4-cyclohexylphenyl)iodanium;1,1,2,2,3,3-hexafluoropropane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)F.c1cc(C2CCCCC2)ccc1[I+]c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C24H30I.C3H2F6O3S/c1-3-7-19(8-4-1)21-11-15-23(16-12-21)25-24-17-13-22(14-18-24)20-9-5-2-6-10-20;4-1(5)2(6,7)3(8,9)13(10,11)12/h11-20H,1-10H2;1H,(H,10,11,12)/q+1;/p-1 |
| InChIKey | ONHAFHPHNXWNDO-UHFFFAOYSA-M |
| XLogP | 4.94 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|