About 6-tert-butyl-2,3-dihydro-1H-inden-1-ol
6-tert-butyl-2,3-dihydro-1H-inden-1-ol (PubChem CID 18402850) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is 6-tert-butyl-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | 6-tert-butyl-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 18402850 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 6-tert-butyl-2,3-dihydro-1H-inden-1-ol |
| SMILES | CC(C)(C)c1ccc2c(c1)C(O)CC2 |
| InChI | InChI=1S/C13H18O/c1-13(2,3)10-6-4-9-5-7-12(14)11(9)8-10/h4,6,8,12,14H,5,7H2,1-3H3 |
| InChIKey | ZFVNKELWXMPTGU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-tert-butyl-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of 6-tert-butyl-2,3-dihydro-1H-inden-1-ol (CID 18402850) is 6-tert-butyl-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for 6-tert-butyl-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for 6-tert-butyl-2,3-dihydro-1H-inden-1-ol is CC(C)(C)c1ccc2c(c1)C(O)CC2.
What is the InChIKey of 6-tert-butyl-2,3-dihydro-1H-inden-1-ol?
The InChIKey is ZFVNKELWXMPTGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O/c1-13(2,3)10-6-4-9-5-7-12(14)11(9)8-10/h4,6,8,12,14H,5,7H2,1-3H3.
What are the key properties of 6-tert-butyl-2,3-dihydro-1H-inden-1-ol?
6-tert-butyl-2,3-dihydro-1H-inden-1-ol has a molecular weight of 190.29 g/mol, XLogP of 2.96, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 18402850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).