About 1,1,3-trihydroxypropan-2-one
1,1,3-trihydroxypropan-2-one (PubChem CID 18403036) has the molecular formula C3H6O4
and a molecular weight of 106.08 g/mol. Its IUPAC name is 1,1,3-trihydroxypropan-2-one.
Molecular Properties
| Compound Name | 1,1,3-trihydroxypropan-2-one |
| PubChem CID | 18403036 |
| Molecular Formula | C3H6O4 |
| Molecular Weight | 106.08 g/mol |
| Exact Mass | 106.03 |
| IUPAC Name | 1,1,3-trihydroxypropan-2-one |
| SMILES | O=C(CO)C(O)O |
| InChI | InChI=1S/C3H6O4/c4-1-2(5)3(6)7/h3-4,6-7H,1H2 |
| InChIKey | WEROPXZATQCXLT-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.08 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1,3-trihydroxypropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,3-trihydroxypropan-2-one?
The IUPAC name of 1,1,3-trihydroxypropan-2-one (CID 18403036) is 1,1,3-trihydroxypropan-2-one.
What is the SMILES notation for 1,1,3-trihydroxypropan-2-one?
The canonical SMILES for 1,1,3-trihydroxypropan-2-one is O=C(CO)C(O)O.
What is the InChIKey of 1,1,3-trihydroxypropan-2-one?
The InChIKey is WEROPXZATQCXLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O4/c4-1-2(5)3(6)7/h3-4,6-7H,1H2.
What are the key properties of 1,1,3-trihydroxypropan-2-one?
1,1,3-trihydroxypropan-2-one has a molecular weight of 106.08 g/mol, XLogP of -2.14, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,3-trihydroxypropan-2-one is sourced from PubChem (CID 18403036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).