About 5-(pyrrolidin-1-ylmethyl)cyclohexa-2,4-diene-1,1-diol
5-(pyrrolidin-1-ylmethyl)cyclohexa-2,4-diene-1,1-diol (PubChem CID 18403794) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is 5-(pyrrolidin-1-ylmethyl)cyclohexa-2,4-diene-1,1-diol.
Molecular Properties
| Compound Name | 5-(pyrrolidin-1-ylmethyl)cyclohexa-2,4-diene-1,1-diol |
| PubChem CID | 18403794 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 5-(pyrrolidin-1-ylmethyl)cyclohexa-2,4-diene-1,1-diol |
| SMILES | OC1(O)C=CC=C(CN2CCCC2)C1 |
| InChI | InChI=1S/C11H17NO2/c13-11(14)5-3-4-10(8-11)9-12-6-1-2-7-12/h3-5,13-14H,1-2,6-9H2 |
| InChIKey | MIVCGEZDBVUPAB-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-(pyrrolidin-1-ylmethyl)cyclohexa-2,4-diene-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(pyrrolidin-1-ylmethyl)cyclohexa-2,4-diene-1,1-diol?
The IUPAC name of 5-(pyrrolidin-1-ylmethyl)cyclohexa-2,4-diene-1,1-diol (CID 18403794) is 5-(pyrrolidin-1-ylmethyl)cyclohexa-2,4-diene-1,1-diol.
What is the SMILES notation for 5-(pyrrolidin-1-ylmethyl)cyclohexa-2,4-diene-1,1-diol?
The canonical SMILES for 5-(pyrrolidin-1-ylmethyl)cyclohexa-2,4-diene-1,1-diol is OC1(O)C=CC=C(CN2CCCC2)C1.
What is the InChIKey of 5-(pyrrolidin-1-ylmethyl)cyclohexa-2,4-diene-1,1-diol?
The InChIKey is MIVCGEZDBVUPAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c13-11(14)5-3-4-10(8-11)9-12-6-1-2-7-12/h3-5,13-14H,1-2,6-9H2.
What are the key properties of 5-(pyrrolidin-1-ylmethyl)cyclohexa-2,4-diene-1,1-diol?
5-(pyrrolidin-1-ylmethyl)cyclohexa-2,4-diene-1,1-diol has a molecular weight of 195.26 g/mol, XLogP of 0.65, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(pyrrolidin-1-ylmethyl)cyclohexa-2,4-diene-1,1-diol is sourced from PubChem (CID 18403794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).