About 3-(2-aminoethyl)-1H-indol-5-ol;2-[carbamimidoyl(methyl)amino]acetic acid;sulfuric acid
3-(2-aminoethyl)-1H-indol-5-ol;2-[carbamimidoyl(methyl)amino]acetic acid;sulfuric acid (PubChem CID 18403964) has the molecular formula C14H23N5O7S
and a molecular weight of 405.43 g/mol. Its IUPAC name is 3-(2-aminoethyl)-1H-indol-5-ol;2-[carbamimidoyl(methyl)amino]acetic acid;sulfuric acid.
Molecular Properties
| Compound Name | 3-(2-aminoethyl)-1H-indol-5-ol;2-[carbamimidoyl(methyl)amino]acetic acid;sulfuric acid |
| PubChem CID | 18403964 |
| Molecular Formula | C14H23N5O7S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 3-(2-aminoethyl)-1H-indol-5-ol;2-[carbamimidoyl(methyl)amino]acetic acid;sulfuric acid |
| SMILES | NCCc1c[nH]c2ccc(O)cc12.O=S(=O)(O)O.[H]/N=C(\N)N(C)CC(=O)O |
| InChI | InChI=1S/C10H12N2O.C4H9N3O2.H2O4S/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10;1-7(4(5)6)2-3(8)9;1-5(2,3)4/h1-2,5-6,12-13H,3-4,11H2;2H2,1H3,(H3,5,6)(H,8,9);(H2,1,2,3,4) |
| InChIKey | PDHYUJPARVVLKD-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 227.05 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-aminoethyl)-1H-indol-5-ol;2-[carbamimidoyl(methyl)amino]acetic acid;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-aminoethyl)-1H-indol-5-ol;2-[carbamimidoyl(methyl)amino]acetic acid;sulfuric acid?
The IUPAC name of 3-(2-aminoethyl)-1H-indol-5-ol;2-[carbamimidoyl(methyl)amino]acetic acid;sulfuric acid (CID 18403964) is 3-(2-aminoethyl)-1H-indol-5-ol;2-[carbamimidoyl(methyl)amino]acetic acid;sulfuric acid.
What is the SMILES notation for 3-(2-aminoethyl)-1H-indol-5-ol;2-[carbamimidoyl(methyl)amino]acetic acid;sulfuric acid?
The canonical SMILES for 3-(2-aminoethyl)-1H-indol-5-ol;2-[carbamimidoyl(methyl)amino]acetic acid;sulfuric acid is NCCc1c[nH]c2ccc(O)cc12.O=S(=O)(O)O.[H]/N=C(\N)N(C)CC(=O)O.
What is the InChIKey of 3-(2-aminoethyl)-1H-indol-5-ol;2-[carbamimidoyl(methyl)amino]acetic acid;sulfuric acid?
The InChIKey is PDHYUJPARVVLKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O.C4H9N3O2.H2O4S/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10;1-7(4(5)6)2-3(8)9;1-5(2,3)4/h1-2,5-6,12-13H,3-4,11H2;2H2,1H3,(H3,5,6)(H,8,9);(H2,1,2,3,4).
What are the key properties of 3-(2-aminoethyl)-1H-indol-5-ol;2-[carbamimidoyl(methyl)amino]acetic acid;sulfuric acid?
3-(2-aminoethyl)-1H-indol-5-ol;2-[carbamimidoyl(methyl)amino]acetic acid;sulfuric acid has a molecular weight of 405.43 g/mol, XLogP of -0.38, 4 rotatable bonds, 8 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminoethyl)-1H-indol-5-ol;2-[carbamimidoyl(methyl)amino]acetic acid;sulfuric acid is sourced from PubChem (CID 18403964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).