About 3-[(triphenyl-λ5-phosphanylidene)amino]thiophene-2-carbaldehyde
3-[(triphenyl-λ5-phosphanylidene)amino]thiophene-2-carbaldehyde (PubChem CID 18404100) has the molecular formula C23H18NOPS
and a molecular weight of 387.44 g/mol. Its IUPAC name is 3-[(triphenyl-λ5-phosphanylidene)amino]thiophene-2-carbaldehyde.
Molecular Properties
| Compound Name | 3-[(triphenyl-λ5-phosphanylidene)amino]thiophene-2-carbaldehyde |
| PubChem CID | 18404100 |
| Molecular Formula | C23H18NOPS |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 3-[(triphenyl-λ5-phosphanylidene)amino]thiophene-2-carbaldehyde |
| SMILES | O=Cc1sccc1N=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H18NOPS/c25-18-23-22(16-17-27-23)24-26(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-18H |
| InChIKey | VQVVVURNCJOINF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[(triphenyl-λ5-phosphanylidene)amino]thiophene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(triphenyl-λ5-phosphanylidene)amino]thiophene-2-carbaldehyde?
The IUPAC name of 3-[(triphenyl-λ5-phosphanylidene)amino]thiophene-2-carbaldehyde (CID 18404100) is 3-[(triphenyl-λ5-phosphanylidene)amino]thiophene-2-carbaldehyde.
What is the SMILES notation for 3-[(triphenyl-λ5-phosphanylidene)amino]thiophene-2-carbaldehyde?
The canonical SMILES for 3-[(triphenyl-λ5-phosphanylidene)amino]thiophene-2-carbaldehyde is O=Cc1sccc1N=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-[(triphenyl-λ5-phosphanylidene)amino]thiophene-2-carbaldehyde?
The InChIKey is VQVVVURNCJOINF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18NOPS/c25-18-23-22(16-17-27-23)24-26(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-18H.
What are the key properties of 3-[(triphenyl-λ5-phosphanylidene)amino]thiophene-2-carbaldehyde?
3-[(triphenyl-λ5-phosphanylidene)amino]thiophene-2-carbaldehyde has a molecular weight of 387.44 g/mol, XLogP of 5.37, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(triphenyl-λ5-phosphanylidene)amino]thiophene-2-carbaldehyde is sourced from PubChem (CID 18404100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).