C11H8BrNOS — CID 18405006
(4-bromo-2-methylphenyl)-(1,3-thiazol-2-yl)methanone (PubChem CID 18405006) has the molecular formula C11H8BrNOS and a molecular weight of 282.16 g/mol. Its IUPAC name is (4-bromo-2-methylphenyl)-(1,3-thiazol-2-yl)methanone.
| Compound Name | (4-bromo-2-methylphenyl)-(1,3-thiazol-2-yl)methanone |
|---|---|
| PubChem CID | 18405006 |
| Molecular Formula | C11H8BrNOS |
| Molecular Weight | 282.16 g/mol |
| Exact Mass | 280.95 |
| IUPAC Name | (4-bromo-2-methylphenyl)-(1,3-thiazol-2-yl)methanone |
| SMILES | Cc1cc(Br)ccc1C(=O)c1nccs1 |
| InChI | InChI=1S/C11H8BrNOS/c1-7-6-8(12)2-3-9(7)10(14)11-13-4-5-15-11/h2-6H,1H3 |
| InChIKey | KTQBSHWLFGTZTA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.16 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |