About 4-[(3,4-dichlorophenyl)methyl]-2-methoxyfuro[3,2-b]pyrrole-5-carboxylic acid
4-[(3,4-dichlorophenyl)methyl]-2-methoxyfuro[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 18405218) has the molecular formula C15H11Cl2NO4
and a molecular weight of 340.16 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methyl]-2-methoxyfuro[3,2-b]pyrrole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-[(3,4-dichlorophenyl)methyl]-2-methoxyfuro[3,2-b]pyrrole-5-carboxylic acid |
| PubChem CID | 18405218 |
| Molecular Formula | C15H11Cl2NO4 |
| Molecular Weight | 340.16 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methyl]-2-methoxyfuro[3,2-b]pyrrole-5-carboxylic acid |
| SMILES | COc1cc2c(cc(C(=O)O)n2Cc2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C15H11Cl2NO4/c1-21-14-6-11-13(22-14)5-12(15(19)20)18(11)7-8-2-3-9(16)10(17)4-8/h2-6H,7H2,1H3,(H,19,20) |
| InChIKey | IBTAGDGFXHASNI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.16 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(3,4-dichlorophenyl)methyl]-2-methoxyfuro[3,2-b]pyrrole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,4-dichlorophenyl)methyl]-2-methoxyfuro[3,2-b]pyrrole-5-carboxylic acid?
The IUPAC name of 4-[(3,4-dichlorophenyl)methyl]-2-methoxyfuro[3,2-b]pyrrole-5-carboxylic acid (CID 18405218) is 4-[(3,4-dichlorophenyl)methyl]-2-methoxyfuro[3,2-b]pyrrole-5-carboxylic acid.
What is the SMILES notation for 4-[(3,4-dichlorophenyl)methyl]-2-methoxyfuro[3,2-b]pyrrole-5-carboxylic acid?
The canonical SMILES for 4-[(3,4-dichlorophenyl)methyl]-2-methoxyfuro[3,2-b]pyrrole-5-carboxylic acid is COc1cc2c(cc(C(=O)O)n2Cc2ccc(Cl)c(Cl)c2)o1.
What is the InChIKey of 4-[(3,4-dichlorophenyl)methyl]-2-methoxyfuro[3,2-b]pyrrole-5-carboxylic acid?
The InChIKey is IBTAGDGFXHASNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Cl2NO4/c1-21-14-6-11-13(22-14)5-12(15(19)20)18(11)7-8-2-3-9(16)10(17)4-8/h2-6H,7H2,1H3,(H,19,20).
What are the key properties of 4-[(3,4-dichlorophenyl)methyl]-2-methoxyfuro[3,2-b]pyrrole-5-carboxylic acid?
4-[(3,4-dichlorophenyl)methyl]-2-methoxyfuro[3,2-b]pyrrole-5-carboxylic acid has a molecular weight of 340.16 g/mol, XLogP of 4.30, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,4-dichlorophenyl)methyl]-2-methoxyfuro[3,2-b]pyrrole-5-carboxylic acid is sourced from PubChem (CID 18405218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).