About ethyl 4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate
ethyl 4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate (PubChem CID 18405245) has the molecular formula C8H8N2O2S
and a molecular weight of 196.23 g/mol. Its IUPAC name is ethyl 4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate |
| PubChem CID | 18405245 |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | ethyl 4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc2scnc2[nH]1 |
| InChI | InChI=1S/C8H8N2O2S/c1-2-12-8(11)5-3-6-7(10-5)9-4-13-6/h3-4,10H,2H2,1H3 |
| InChIKey | BXACPZGBYFAFIX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate?
The IUPAC name of ethyl 4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate (CID 18405245) is ethyl 4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate.
What is the SMILES notation for ethyl 4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate?
The canonical SMILES for ethyl 4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate is CCOC(=O)c1cc2scnc2[nH]1.
What is the InChIKey of ethyl 4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate?
The InChIKey is BXACPZGBYFAFIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2S/c1-2-12-8(11)5-3-6-7(10-5)9-4-13-6/h3-4,10H,2H2,1H3.
What are the key properties of ethyl 4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate?
ethyl 4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate has a molecular weight of 196.23 g/mol, XLogP of 1.80, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate is sourced from PubChem (CID 18405245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).