C17H22N2O4 — CID 18405712
2-(2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-4-yl)ethanamine;(E)-but-2-enedioic acid (PubChem CID 18405712) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-(2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-4-yl)ethanamine;(E)-but-2-enedioic acid.
| Compound Name | 2-(2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-4-yl)ethanamine;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 18405712 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2-(2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-4-yl)ethanamine;(E)-but-2-enedioic acid |
| SMILES | NCCN1c2ccccc2C2CCCC21.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C13H18N2.C4H4O4/c14-8-9-15-12-6-2-1-4-10(12)11-5-3-7-13(11)15;5-3(6)1-2-4(7)8/h1-2,4,6,11,13H,3,5,7-9,14H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | BTRGUXCFFMIPJW-WLHGVMLRSA-N |
| XLogP | 1.81 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|