About furan-2,5-dione;propan-2-one
furan-2,5-dione;propan-2-one (PubChem CID 18405815) has the molecular formula C7H8O4
and a molecular weight of 156.14 g/mol. Its IUPAC name is furan-2,5-dione;propan-2-one.
Molecular Properties
| Compound Name | furan-2,5-dione;propan-2-one |
| PubChem CID | 18405815 |
| Molecular Formula | C7H8O4 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | furan-2,5-dione;propan-2-one |
| SMILES | CC(C)=O.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C4H2O3.C3H6O/c5-3-1-2-4(6)7-3;1-3(2)4/h1-2H;1-2H3 |
| InChIKey | WQECNUVITHHPKC-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze furan-2,5-dione;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2,5-dione;propan-2-one?
The IUPAC name of furan-2,5-dione;propan-2-one (CID 18405815) is furan-2,5-dione;propan-2-one.
What is the SMILES notation for furan-2,5-dione;propan-2-one?
The canonical SMILES for furan-2,5-dione;propan-2-one is CC(C)=O.O=C1C=CC(=O)O1.
What is the InChIKey of furan-2,5-dione;propan-2-one?
The InChIKey is WQECNUVITHHPKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2O3.C3H6O/c5-3-1-2-4(6)7-3;1-3(2)4/h1-2H;1-2H3.
What are the key properties of furan-2,5-dione;propan-2-one?
furan-2,5-dione;propan-2-one has a molecular weight of 156.14 g/mol, XLogP of 0.22, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2,5-dione;propan-2-one is sourced from PubChem (CID 18405815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).