About S-propyl prop-2-enethioate
S-propyl prop-2-enethioate (PubChem CID 18405864) has the molecular formula C6H10OS
and a molecular weight of 130.21 g/mol. Its IUPAC name is S-propyl prop-2-enethioate.
Molecular Properties
| Compound Name | S-propyl prop-2-enethioate |
| PubChem CID | 18405864 |
| Molecular Formula | C6H10OS |
| Molecular Weight | 130.21 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | S-propyl prop-2-enethioate |
| SMILES | C=CC(=O)SCCC |
| InChI | InChI=1S/C6H10OS/c1-3-5-8-6(7)4-2/h4H,2-3,5H2,1H3 |
| InChIKey | DUVRKBKLADUXIC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.21 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-propyl prop-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-propyl prop-2-enethioate?
The IUPAC name of S-propyl prop-2-enethioate (CID 18405864) is S-propyl prop-2-enethioate.
What is the SMILES notation for S-propyl prop-2-enethioate?
The canonical SMILES for S-propyl prop-2-enethioate is C=CC(=O)SCCC.
What is the InChIKey of S-propyl prop-2-enethioate?
The InChIKey is DUVRKBKLADUXIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10OS/c1-3-5-8-6(7)4-2/h4H,2-3,5H2,1H3.
What are the key properties of S-propyl prop-2-enethioate?
S-propyl prop-2-enethioate has a molecular weight of 130.21 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-propyl prop-2-enethioate is sourced from PubChem (CID 18405864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).