About 1-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid
1-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid (PubChem CID 18405949) has the molecular formula C9H19N2O2P
and a molecular weight of 218.24 g/mol. Its IUPAC name is 1-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid.
Molecular Properties
| Compound Name | 1-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid |
| PubChem CID | 18405949 |
| Molecular Formula | C9H19N2O2P |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 1-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid |
| SMILES | CC(C#N)OP(O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C9H19N2O2P/c1-7(2)11(8(3)4)14(12)13-9(5)6-10/h7-9,12H,1-5H3 |
| InChIKey | AYKBTKYREQOCLM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid?
The IUPAC name of 1-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid (CID 18405949) is 1-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid.
What is the SMILES notation for 1-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid?
The canonical SMILES for 1-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid is CC(C#N)OP(O)N(C(C)C)C(C)C.
What is the InChIKey of 1-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid?
The InChIKey is AYKBTKYREQOCLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N2O2P/c1-7(2)11(8(3)4)14(12)13-9(5)6-10/h7-9,12H,1-5H3.
What are the key properties of 1-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid?
1-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid has a molecular weight of 218.24 g/mol, XLogP of 2.25, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid is sourced from PubChem (CID 18405949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).