C18H21NO6S — CID 18406828
N,2-dihydroxy-3,3-dimethyl-4-(2-phenoxyphenyl)sulfonylbutanamide (PubChem CID 18406828) has the molecular formula C18H21NO6S and a molecular weight of 379.43 g/mol. Its IUPAC name is N,2-dihydroxy-3,3-dimethyl-4-(2-phenoxyphenyl)sulfonylbutanamide.
| Compound Name | N,2-dihydroxy-3,3-dimethyl-4-(2-phenoxyphenyl)sulfonylbutanamide |
|---|---|
| PubChem CID | 18406828 |
| Molecular Formula | C18H21NO6S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N,2-dihydroxy-3,3-dimethyl-4-(2-phenoxyphenyl)sulfonylbutanamide |
| SMILES | CC(C)(CS(=O)(=O)c1ccccc1Oc1ccccc1)C(O)C(=O)NO |
| InChI | InChI=1S/C18H21NO6S/c1-18(2,16(20)17(21)19-22)12-26(23,24)15-11-7-6-10-14(15)25-13-8-4-3-5-9-13/h3-11,16,20,22H,12H2,1-2H3,(H,19,21) |
| InChIKey | MGAGDUZRQVBDSP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|