About [2-(2-fluoroethyl)-1,2,4-triazol-3-yl]methanol
[2-(2-fluoroethyl)-1,2,4-triazol-3-yl]methanol (PubChem CID 18406845) has the molecular formula C5H8FN3O
and a molecular weight of 145.14 g/mol. Its IUPAC name is [2-(2-fluoroethyl)-1,2,4-triazol-3-yl]methanol.
Molecular Properties
| Compound Name | [2-(2-fluoroethyl)-1,2,4-triazol-3-yl]methanol |
| PubChem CID | 18406845 |
| Molecular Formula | C5H8FN3O |
| Molecular Weight | 145.14 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | [2-(2-fluoroethyl)-1,2,4-triazol-3-yl]methanol |
| SMILES | OCc1ncnn1CCF |
| InChI | InChI=1S/C5H8FN3O/c6-1-2-9-5(3-10)7-4-8-9/h4,10H,1-3H2 |
| InChIKey | NDJBQGXMTUAPFQ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.14 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(2-fluoroethyl)-1,2,4-triazol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-fluoroethyl)-1,2,4-triazol-3-yl]methanol?
The IUPAC name of [2-(2-fluoroethyl)-1,2,4-triazol-3-yl]methanol (CID 18406845) is [2-(2-fluoroethyl)-1,2,4-triazol-3-yl]methanol.
What is the SMILES notation for [2-(2-fluoroethyl)-1,2,4-triazol-3-yl]methanol?
The canonical SMILES for [2-(2-fluoroethyl)-1,2,4-triazol-3-yl]methanol is OCc1ncnn1CCF.
What is the InChIKey of [2-(2-fluoroethyl)-1,2,4-triazol-3-yl]methanol?
The InChIKey is NDJBQGXMTUAPFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8FN3O/c6-1-2-9-5(3-10)7-4-8-9/h4,10H,1-3H2.
What are the key properties of [2-(2-fluoroethyl)-1,2,4-triazol-3-yl]methanol?
[2-(2-fluoroethyl)-1,2,4-triazol-3-yl]methanol has a molecular weight of 145.14 g/mol, XLogP of -0.26, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-fluoroethyl)-1,2,4-triazol-3-yl]methanol is sourced from PubChem (CID 18406845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).