C21H14F3N7O — CID 18406905
7-(2,6-difluorophenyl)-3-(2-fluorophenyl)-2-[(2-methyl-1,2,4-triazol-3-yl)methoxy]pyrazolo[1,5-d][1,2,4]triazine (PubChem CID 18406905) has the molecular formula C21H14F3N7O and a molecular weight of 437.39 g/mol. Its IUPAC name is 7-(2,6-difluorophenyl)-3-(2-fluorophenyl)-2-[(2-methyl-1,2,4-triazol-3-yl)methoxy]pyrazolo[1,5-d][1,2,4]triazine.
| Compound Name | 7-(2,6-difluorophenyl)-3-(2-fluorophenyl)-2-[(2-methyl-1,2,4-triazol-3-yl)methoxy]pyrazolo[1,5-d][1,2,4]triazine |
|---|---|
| PubChem CID | 18406905 |
| Molecular Formula | C21H14F3N7O |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 7-(2,6-difluorophenyl)-3-(2-fluorophenyl)-2-[(2-methyl-1,2,4-triazol-3-yl)methoxy]pyrazolo[1,5-d][1,2,4]triazine |
| SMILES | Cn1ncnc1COc1nn2c(-c3c(F)cccc3F)nncc2c1-c1ccccc1F |
| InChI | InChI=1S/C21H14F3N7O/c1-30-17(25-11-27-30)10-32-21-18(12-5-2-3-6-13(12)22)16-9-26-28-20(31(16)29-21)19-14(23)7-4-8-15(19)24/h2-9,11H,10H2,1H3 |
| InChIKey | COIHYICCVMGEJO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 83.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |