About 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine
5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine (PubChem CID 18406919) has the molecular formula C5H8N4
and a molecular weight of 124.15 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine.
Analyze 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine?
The IUPAC name of 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine (CID 18406919) is 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine.
What is the SMILES notation for 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine?
The canonical SMILES for 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine is c1nc2n(n1)CCNC2.
What is the InChIKey of 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine?
The InChIKey is DXJKRLHHCGXHMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4/c1-2-9-5(3-6-1)7-4-8-9/h4,6H,1-3H2.
What are the key properties of 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine?
5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine has a molecular weight of 124.15 g/mol, XLogP of -0.62, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine is sourced from PubChem (CID 18406919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).