C25H29N5O4 — CID 18407573
2-[3-oxo-4-[[3-[4-[N'-(2-phenylethyl)carbamimidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperazin-1-yl]acetic acid (PubChem CID 18407573) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is 2-[3-oxo-4-[[3-[4-[N'-(2-phenylethyl)carbamimidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[3-oxo-4-[[3-[4-[N'-(2-phenylethyl)carbamimidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 18407573 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 2-[3-oxo-4-[[3-[4-[N'-(2-phenylethyl)carbamimidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperazin-1-yl]acetic acid |
| SMILES | N/C(=N\CCc1ccccc1)c1ccc(C2=NOC(CN3CCN(CC(=O)O)CC3=O)C2)cc1 |
| InChI | InChI=1S/C25H29N5O4/c26-25(27-11-10-18-4-2-1-3-5-18)20-8-6-19(7-9-20)22-14-21(34-28-22)15-30-13-12-29(16-23(30)31)17-24(32)33/h1-9,21H,10-17H2,(H2,26,27)(H,32,33) |
| InChIKey | RGBCZRZZQZEDCN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 120.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|