C22H32N6O3 — CID 18407574
2-[4-[[3-[4-[(E)-(4-methylpiperazin-1-yl)iminomethyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperazin-1-yl]acetic acid (PubChem CID 18407574) has the molecular formula C22H32N6O3 and a molecular weight of 428.54 g/mol. Its IUPAC name is 2-[4-[[3-[4-[(E)-(4-methylpiperazin-1-yl)iminomethyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[[3-[4-[(E)-(4-methylpiperazin-1-yl)iminomethyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 18407574 |
| Molecular Formula | C22H32N6O3 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 2-[4-[[3-[4-[(E)-(4-methylpiperazin-1-yl)iminomethyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperazin-1-yl]acetic acid |
| SMILES | CN1CCN(/N=C/c2ccc(C3=NOC(CN4CCN(CC(=O)O)CC4)C3)cc2)CC1 |
| InChI | InChI=1S/C22H32N6O3/c1-25-6-12-28(13-7-25)23-15-18-2-4-19(5-3-18)21-14-20(31-24-21)16-26-8-10-27(11-9-26)17-22(29)30/h2-5,15,20H,6-14,16-17H2,1H3,(H,29,30)/b23-15+ |
| InChIKey | GOTWNAPYNSVGNA-HZHRSRAPSA-N |
| XLogP | 0.46 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|